C18H18F7N3O — CID 59684915
N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3-dimethylphenyl]-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 59684915) has the molecular formula C18H18F7N3O and a molecular weight of 425.35 g/mol. Its IUPAC name is N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3-dimethylphenyl]-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3-dimethylphenyl]-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59684915 |
| Molecular Formula | C18H18F7N3O |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3-dimethylphenyl]-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C18H18F7N3O/c1-8-9(2)13(26-15(29)14-10(3)27-28(5)11(14)4)7-6-12(8)16(19,17(20,21)22)18(23,24)25/h6-7H,1-5H3,(H,26,29) |
| InChIKey | VDJIAFQCFWLCOZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |