C33H30FN5O5S2 — CID 59684966
N-[3-fluoro-4-[2-[4-[(2-methylperoxysulfanylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-2-oxo-3-phenylimidazolidine-1-carboxamide (PubChem CID 59684966) has the molecular formula C33H30FN5O5S2 and a molecular weight of 659.77 g/mol. Its IUPAC name is N-[3-fluoro-4-[2-[4-[(2-methylperoxysulfanylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-2-oxo-3-phenylimidazolidine-1-carboxamide.
| Compound Name | N-[3-fluoro-4-[2-[4-[(2-methylperoxysulfanylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-2-oxo-3-phenylimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 59684966 |
| Molecular Formula | C33H30FN5O5S2 |
| Molecular Weight | 659.77 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | N-[3-fluoro-4-[2-[4-[(2-methylperoxysulfanylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-2-oxo-3-phenylimidazolidine-1-carboxamide |
| SMILES | COOSCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)N5CCN(c6ccccc6)C5=O)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C33H30FN5O5S2/c1-42-44-45-18-15-35-21-22-7-9-23(10-8-22)30-20-27-31(46-30)29(13-14-36-27)43-28-12-11-24(19-26(28)34)37-32(40)39-17-16-38(33(39)41)25-5-3-2-4-6-25/h2-14,19-20,35H,15-18,21H2,1H3,(H,37,40) |
| InChIKey | ZSBLCPUGZFTRIF-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|