C23H36N2O7S — CID 59685128
2-acetamido-2-[(2R,3S,4R)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbonyl]sulfanylacetic acid (PubChem CID 59685128) has the molecular formula C23H36N2O7S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-acetamido-2-[(2R,3S,4R)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbonyl]sulfanylacetic acid.
| Compound Name | 2-acetamido-2-[(2R,3S,4R)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbonyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 59685128 |
| Molecular Formula | C23H36N2O7S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-acetamido-2-[(2R,3S,4R)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbonyl]sulfanylacetic acid |
| SMILES | CCCCCC[C@H]1C(=O)N[C@](C(=O)SC(NC(C)=O)C(=O)O)(C(O)[C@@H]2C=CCCC2)[C@@]1(C)O |
| InChI | InChI=1S/C23H36N2O7S/c1-4-5-6-10-13-16-18(28)25-23(22(16,3)32,17(27)15-11-8-7-9-12-15)21(31)33-19(20(29)30)24-14(2)26/h8,11,15-17,19,27,32H,4-7,9-10,12-13H2,1-3H3,(H,24,26)(H,25,28)(H,29,30)/t15-,16+,17?,19?,22+,23+/m1/s1 |
| InChIKey | QKGMMGZBAYEWBT-SMGIDNOXSA-N |
| XLogP | 1.72 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|