About 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate
2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate (PubChem CID 59685216) has the molecular formula C19H26O12
and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate |
| PubChem CID | 59685216 |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H26O12/c1-6-15(24)25-7-8-26-19-18(30-13(5)23)17(29-12(4)22)16(28-11(3)21)14(31-19)9-27-10(2)20/h6,14,16-19H,1,7-9H2,2-5H3 |
| InChIKey | XGCVASALBGQZAE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate?
The IUPAC name of 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate (CID 59685216) is 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate.
What is the SMILES notation for 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate?
The canonical SMILES for 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate is C=CC(=O)OCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate?
The InChIKey is XGCVASALBGQZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O12/c1-6-15(24)25-7-8-26-19-18(30-13(5)23)17(29-12(4)22)16(28-11(3)21)14(31-19)9-27-10(2)20/h6,14,16-19H,1,7-9H2,2-5H3.
What are the key properties of 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate?
2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate has a molecular weight of 446.41 g/mol, XLogP of -0.18, 10 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl prop-2-enoate is sourced from PubChem (CID 59685216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).