C24H22N6O2S — CID 59685525
3-(1,3-benzothiazol-2-yl)-7-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methyl]chromen-2-one (PubChem CID 59685525) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methyl]chromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 59685525 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methyl]chromen-2-one |
| SMILES | CN(C)c1nc(Cc2ccc3cc(-c4nc5ccccc5s4)c(=O)oc3c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C24H22N6O2S/c1-29(2)23-26-20(27-24(28-23)30(3)4)12-14-9-10-15-13-16(22(31)32-18(15)11-14)21-25-17-7-5-6-8-19(17)33-21/h5-11,13H,12H2,1-4H3 |
| InChIKey | PZHQOWJIGJLTIY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|