About 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol (PubChem CID 59685548) has the molecular formula C18H18F6IrNO2-
and a molecular weight of 586.55 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol |
| PubChem CID | 59685548 |
| Molecular Formula | C18H18F6IrNO2- |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C13H6F6N.C5H12O2.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;1-4(6)3-5(2)7;/h1-5,7H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | FRGQGYJRTHQCRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol (CID 59685548) is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol is CC(O)CC(C)O.FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.[Ir].
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol?
The InChIKey is FRGQGYJRTHQCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F6N.C5H12O2.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;1-4(6)3-5(2)7;/h1-5,7H;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol?
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol has a molecular weight of 586.55 g/mol, XLogP of 4.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pentane-2,4-diol is sourced from PubChem (CID 59685548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).