C25H47F3N6 — CID 59685767
8-N-[[4-(1,1,1-trifluorobutan-2-yl)phenyl]methyl]tetradecane-3,4,7,8,11,12-hexamine (PubChem CID 59685767) has the molecular formula C25H47F3N6 and a molecular weight of 488.69 g/mol. Its IUPAC name is 8-N-[[4-(1,1,1-trifluorobutan-2-yl)phenyl]methyl]tetradecane-3,4,7,8,11,12-hexamine.
| Compound Name | 8-N-[[4-(1,1,1-trifluorobutan-2-yl)phenyl]methyl]tetradecane-3,4,7,8,11,12-hexamine |
|---|---|
| PubChem CID | 59685767 |
| Molecular Formula | C25H47F3N6 |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.38 |
| IUPAC Name | 8-N-[[4-(1,1,1-trifluorobutan-2-yl)phenyl]methyl]tetradecane-3,4,7,8,11,12-hexamine |
| SMILES | CCC(N)C(N)CCC(N)C(CCC(N)C(N)CC)NCc1ccc(C(CC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H47F3N6/c1-4-18(25(26,27)28)17-9-7-16(8-10-17)15-34-24(14-13-22(32)20(30)6-3)23(33)12-11-21(31)19(29)5-2/h7-10,18-24,34H,4-6,11-15,29-33H2,1-3H3 |
| InChIKey | BUFYPYHQTWDRAK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |