C22H25Cl2N3O — CID 59686171
[3-(4-chlorophenyl)-2-propan-2-yl-2,7-diazaspiro[3.5]nonan-7-yl]-(2-chloro-3-pyridinyl)methanone (PubChem CID 59686171) has the molecular formula C22H25Cl2N3O and a molecular weight of 418.37 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-2-propan-2-yl-2,7-diazaspiro[3.5]nonan-7-yl]-(2-chloro-3-pyridinyl)methanone.
| Compound Name | [3-(4-chlorophenyl)-2-propan-2-yl-2,7-diazaspiro[3.5]nonan-7-yl]-(2-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 59686171 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [3-(4-chlorophenyl)-2-propan-2-yl-2,7-diazaspiro[3.5]nonan-7-yl]-(2-chloro-3-pyridinyl)methanone |
| SMILES | CC(C)N1CC2(CCN(C(=O)c3cccnc3Cl)CC2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O/c1-15(2)27-14-22(19(27)16-5-7-17(23)8-6-16)9-12-26(13-10-22)21(28)18-4-3-11-25-20(18)24/h3-8,11,15,19H,9-10,12-14H2,1-2H3 |
| InChIKey | QCIIEYRMOWYUTN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|