C12H6BrClF2N2O2S — CID 59686272
2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine 6,6-dioxide (PubChem CID 59686272) has the molecular formula C12H6BrClF2N2O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine 6,6-dioxide.
| Compound Name | 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine 6,6-dioxide |
|---|---|
| PubChem CID | 59686272 |
| Molecular Formula | C12H6BrClF2N2O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine 6,6-dioxide |
| SMILES | O=S1(=O)Cc2nc(-c3cc(F)c(Br)cc3F)nc(Cl)c2C1 |
| InChI | InChI=1S/C12H6BrClF2N2O2S/c13-7-2-8(15)5(1-9(7)16)12-17-10-4-21(19,20)3-6(10)11(14)18-12/h1-2H,3-4H2 |
| InChIKey | LWUULKLKQRISMQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|