C12H6BrClF2N2S — CID 59686306
2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 59686306) has the molecular formula C12H6BrClF2N2S and a molecular weight of 363.61 g/mol. Its IUPAC name is 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine.
| Compound Name | 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 59686306 |
| Molecular Formula | C12H6BrClF2N2S |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | 2-(4-bromo-2,5-difluorophenyl)-4-chloro-5,7-dihydrothieno[3,4-d]pyrimidine |
| SMILES | Fc1cc(-c2nc(Cl)c3c(n2)CSC3)c(F)cc1Br |
| InChI | InChI=1S/C12H6BrClF2N2S/c13-7-2-8(15)5(1-9(7)16)12-17-10-4-19-3-6(10)11(14)18-12/h1-2H,3-4H2 |
| InChIKey | BCXAQHUPGNQOSD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|