About 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine
2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 59686728) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine |
| PubChem CID | 59686728 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | COC1=CC2C(CCN)=CNC2C=C1 |
| InChI | InChI=1S/C11H16N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,10-11,13H,4-5,12H2,1H3 |
| InChIKey | IFTKMYLZQBGWNM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The IUPAC name of 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine (CID 59686728) is 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine.
What is the SMILES notation for 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The canonical SMILES for 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine is COC1=CC2C(CCN)=CNC2C=C1.
What is the InChIKey of 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine?
The InChIKey is IFTKMYLZQBGWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,10-11,13H,4-5,12H2,1H3.
What are the key properties of 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine?
2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine has a molecular weight of 192.26 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)ethanamine is sourced from PubChem (CID 59686728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).