About 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane
13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane (PubChem CID 59686750) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane.
Molecular Properties
| Compound Name | 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane |
| PubChem CID | 59686750 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane |
| SMILES | CC(C)C1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C14H28O4/c1-13(2)14-3-5-15-7-9-17-11-12-18-10-8-16-6-4-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | AENAOQYOUKGMGX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane?
The IUPAC name of 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane (CID 59686750) is 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane.
What is the SMILES notation for 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane?
The canonical SMILES for 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane is CC(C)C1CCOCCOCCOCCOCC1.
What is the InChIKey of 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane?
The InChIKey is AENAOQYOUKGMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4/c1-13(2)14-3-5-15-7-9-17-11-12-18-10-8-16-6-4-14/h13-14H,3-12H2,1-2H3.
What are the key properties of 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane?
13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane has a molecular weight of 260.37 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 13-propan-2-yl-1,4,7,10-tetraoxacyclopentadecane is sourced from PubChem (CID 59686750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).