About 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone
1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone (PubChem CID 59686917) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone.
Molecular Properties
| Compound Name | 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone |
| PubChem CID | 59686917 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone |
| SMILES | CC(=O)C12CC3CC(CC1C3)C2c1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-11(18)17-10-12-7-14(9-15(17)8-12)16(17)13-5-3-2-4-6-13/h2-6,12,14-16H,7-10H2,1H3 |
| InChIKey | YOYBVLROURHQDB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The IUPAC name of 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone (CID 59686917) is 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone.
What is the SMILES notation for 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The canonical SMILES for 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone is CC(=O)C12CC3CC(CC1C3)C2c1ccccc1.
What is the InChIKey of 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The InChIKey is YOYBVLROURHQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c1-11(18)17-10-12-7-14(9-15(17)8-12)16(17)13-5-3-2-4-6-13/h2-6,12,14-16H,7-10H2,1H3.
What are the key properties of 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone has a molecular weight of 240.35 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone is sourced from PubChem (CID 59686917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).