C25H28ClN3O2 — CID 59687155
(8S)-8-[(3-chlorophenyl)methyl]-N-[(1S)-2-methoxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 59687155) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is (8S)-8-[(3-chlorophenyl)methyl]-N-[(1S)-2-methoxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | (8S)-8-[(3-chlorophenyl)methyl]-N-[(1S)-2-methoxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 59687155 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (8S)-8-[(3-chlorophenyl)methyl]-N-[(1S)-2-methoxy-1-phenylethyl]-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | COC[C@@H](NC(=O)c1n[nH]c2c1CCCC[C@H]2Cc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3O2/c1-31-16-22(18-9-3-2-4-10-18)27-25(30)24-21-13-6-5-11-19(23(21)28-29-24)14-17-8-7-12-20(26)15-17/h2-4,7-10,12,15,19,22H,5-6,11,13-14,16H2,1H3,(H,27,30)(H,28,29)/t19-,22+/m0/s1 |
| InChIKey | ZOLWLVKHJNOVPE-SIKLNZKXSA-N |
| XLogP | 5.23 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |