About (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide
(E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide (PubChem CID 59687239) has the molecular formula C11H15N3O3
and a molecular weight of 237.26 g/mol. Its IUPAC name is (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide |
| PubChem CID | 59687239 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C=C/c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O3/c1-3-6-12-9(15)5-4-8-7-14(2)11(17)13-10(8)16/h4-5,7H,3,6H2,1-2H3,(H,12,15)(H,13,16,17)/b5-4+ |
| InChIKey | OQLORFUNJRUVPH-SNAWJCMRSA-N |
| XLogP | -0.39 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide?
The IUPAC name of (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide (CID 59687239) is (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide.
What is the SMILES notation for (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide?
The canonical SMILES for (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide is CCCNC(=O)/C=C/c1cn(C)c(=O)[nH]c1=O.
What is the InChIKey of (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide?
The InChIKey is OQLORFUNJRUVPH-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H15N3O3/c1-3-6-12-9(15)5-4-8-7-14(2)11(17)13-10(8)16/h4-5,7H,3,6H2,1-2H3,(H,12,15)(H,13,16,17)/b5-4+.
What are the key properties of (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide?
(E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide has a molecular weight of 237.26 g/mol, XLogP of -0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-methyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide is sourced from PubChem (CID 59687239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).