C19H31N5O3 — CID 59687281
(E)-3-(4-acetamido-1-tert-butyl-2-oxopyrimidin-5-yl)-N-[2-(tert-butylamino)ethyl]prop-2-enamide (PubChem CID 59687281) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is (E)-3-(4-acetamido-1-tert-butyl-2-oxopyrimidin-5-yl)-N-[2-(tert-butylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-acetamido-1-tert-butyl-2-oxopyrimidin-5-yl)-N-[2-(tert-butylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 59687281 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (E)-3-(4-acetamido-1-tert-butyl-2-oxopyrimidin-5-yl)-N-[2-(tert-butylamino)ethyl]prop-2-enamide |
| SMILES | CC(=O)Nc1nc(=O)n(C(C)(C)C)cc1/C=C/C(=O)NCCNC(C)(C)C |
| InChI | InChI=1S/C19H31N5O3/c1-13(25)22-16-14(12-24(17(27)23-16)19(5,6)7)8-9-15(26)20-10-11-21-18(2,3)4/h8-9,12,21H,10-11H2,1-7H3,(H,20,26)(H,22,23,25,27)/b9-8+ |
| InChIKey | FRACSSVVFBCUMP-CMDGGOBGSA-N |
| XLogP | 1.47 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|