C22H15F6NO5 — CID 59687377
(5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione (PubChem CID 59687377) has the molecular formula C22H15F6NO5 and a molecular weight of 487.35 g/mol. Its IUPAC name is (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione.
| Compound Name | (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59687377 |
| Molecular Formula | C22H15F6NO5 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione |
| SMILES | C=c1cc/c(=C2/C(=O)C(=O)C(c3ccc(N(CC(F)(F)F)CC(F)(F)F)cc3O)=C2O)c(O)c1 |
| InChI | InChI=1S/C22H15F6NO5/c1-10-2-4-12(14(30)6-10)16-18(32)17(20(34)19(16)33)13-5-3-11(7-15(13)31)29(8-21(23,24)25)9-22(26,27)28/h2-7,30-32H,1,8-9H2/b16-12- |
| InChIKey | WNQVQAWMUAAMMX-VBKFSLOCSA-N |
| XLogP | 2.71 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|