C32H28F16O3Si — CID 59687605
triethoxy-[4-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phenyl]phenyl]phenyl]silane (PubChem CID 59687605) has the molecular formula C32H28F16O3Si and a molecular weight of 792.63 g/mol. Its IUPAC name is triethoxy-[4-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phenyl]phenyl]phenyl]silane.
| Compound Name | triethoxy-[4-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phenyl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 59687605 |
| Molecular Formula | C32H28F16O3Si |
| Molecular Weight | 792.63 g/mol |
| Exact Mass | 792.16 |
| IUPAC Name | triethoxy-[4-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl)phenyl]phenyl]phenyl]silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(-c2ccc(-c3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H28F16O3Si/c1-4-49-52(50-5-2,51-6-3)24-17-13-22(14-18-24)20-9-7-19(8-10-20)21-11-15-23(16-12-21)26(35,36)28(39,40)30(43,44)32(47,48)31(45,46)29(41,42)27(37,38)25(33)34/h7-18,25H,4-6H2,1-3H3 |
| InChIKey | UAPBGWRQWJLYCZ-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.63 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|