About [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate
[6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate (PubChem CID 59687773) has the molecular formula C23H40O6
and a molecular weight of 412.57 g/mol. Its IUPAC name is [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate |
| PubChem CID | 59687773 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCCC(CC2CCCC(OC(=O)C(C)(C)CC)O2)O1 |
| InChI | InChI=1S/C23H40O6/c1-7-22(3,4)20(24)28-18-13-9-11-16(26-18)15-17-12-10-14-19(27-17)29-21(25)23(5,6)8-2/h16-19H,7-15H2,1-6H3 |
| InChIKey | LUJPYMTWOABXPQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate?
The IUPAC name of [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate (CID 59687773) is [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate.
What is the SMILES notation for [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate?
The canonical SMILES for [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1CCCC(CC2CCCC(OC(=O)C(C)(C)CC)O2)O1.
What is the InChIKey of [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate?
The InChIKey is LUJPYMTWOABXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O6/c1-7-22(3,4)20(24)28-18-13-9-11-16(26-18)15-17-12-10-14-19(27-17)29-21(25)23(5,6)8-2/h16-19H,7-15H2,1-6H3.
What are the key properties of [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate?
[6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate has a molecular weight of 412.57 g/mol, XLogP of 5.13, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[[6-(2,2-dimethylbutanoyloxy)oxan-2-yl]methyl]oxan-2-yl] 2,2-dimethylbutanoate is sourced from PubChem (CID 59687773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).