C24H8O12S2 — CID 59687831
6,8,17,19-tetraoxo-22-(trioxidanylsulfanyl)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-sulfonic acid (PubChem CID 59687831) has the molecular formula C24H8O12S2 and a molecular weight of 552.45 g/mol. Its IUPAC name is 6,8,17,19-tetraoxo-22-(trioxidanylsulfanyl)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-sulfonic acid.
| Compound Name | 6,8,17,19-tetraoxo-22-(trioxidanylsulfanyl)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-sulfonic acid |
|---|---|
| PubChem CID | 59687831 |
| Molecular Formula | C24H8O12S2 |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 551.95 |
| IUPAC Name | 6,8,17,19-tetraoxo-22-(trioxidanylsulfanyl)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-sulfonic acid |
| SMILES | O=C1OC(=O)c2cc(SOOO)c3c4ccc5c6c(cc(S(=O)(=O)O)c(c7ccc1c2c73)c64)C(=O)OC5=O |
| InChI | InChI=1S/C24H8O12S2/c25-21-9-4-2-8-18-14(38(30,31)32)6-12-16-10(22(26)34-24(12)28)3-1-7(20(16)18)17-13(37-36-35-29)5-11(23(27)33-21)15(9)19(8)17/h1-6,29H,(H,30,31,32) |
| InChIKey | CQVGTWQZJVDEAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|