C24H47N3O9 — CID 59687886
2-[1,3-bis(1,3-dimethoxypropan-2-yloxy)propan-2-yloxy]-N-[4-[(Z)-2-(prop-1-en-2-ylamino)ethylideneamino]oxybutyl]acetamide (PubChem CID 59687886) has the molecular formula C24H47N3O9 and a molecular weight of 521.65 g/mol. Its IUPAC name is 2-[1,3-bis(1,3-dimethoxypropan-2-yloxy)propan-2-yloxy]-N-[4-[(Z)-2-(prop-1-en-2-ylamino)ethylideneamino]oxybutyl]acetamide.
| Compound Name | 2-[1,3-bis(1,3-dimethoxypropan-2-yloxy)propan-2-yloxy]-N-[4-[(Z)-2-(prop-1-en-2-ylamino)ethylideneamino]oxybutyl]acetamide |
|---|---|
| PubChem CID | 59687886 |
| Molecular Formula | C24H47N3O9 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 2-[1,3-bis(1,3-dimethoxypropan-2-yloxy)propan-2-yloxy]-N-[4-[(Z)-2-(prop-1-en-2-ylamino)ethylideneamino]oxybutyl]acetamide |
| SMILES | C=C(C)NC/C=N\OCCCCNC(=O)COC(COC(COC)COC)COC(COC)COC |
| InChI | InChI=1S/C24H47N3O9/c1-20(2)25-10-11-27-36-12-8-7-9-26-24(28)19-35-23(17-33-21(13-29-3)14-30-4)18-34-22(15-31-5)16-32-6/h11,21-23,25H,1,7-10,12-19H2,2-6H3,(H,26,28)/b27-11- |
| InChIKey | HFRMZLGSWOPVDX-BCHBDCPOSA-N |
| XLogP | 0.75 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|