About 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid
7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid (PubChem CID 59687898) has the molecular formula C15H23NO5S
and a molecular weight of 329.42 g/mol. Its IUPAC name is 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid.
Molecular Properties
| Compound Name | 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid |
| PubChem CID | 59687898 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid |
| SMILES | CC(=O)CCN1C(=O)CC(SCCCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C15H23NO5S/c1-11(17)7-8-16-13(18)10-12(15(16)21)22-9-5-3-2-4-6-14(19)20/h12H,2-10H2,1H3,(H,19,20) |
| InChIKey | GTFKIBOMOJBUOM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid?
The IUPAC name of 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid (CID 59687898) is 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid.
What is the SMILES notation for 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid?
The canonical SMILES for 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid is CC(=O)CCN1C(=O)CC(SCCCCCCC(=O)O)C1=O.
What is the InChIKey of 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid?
The InChIKey is GTFKIBOMOJBUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO5S/c1-11(17)7-8-16-13(18)10-12(15(16)21)22-9-5-3-2-4-6-14(19)20/h12H,2-10H2,1H3,(H,19,20).
What are the key properties of 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid?
7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid has a molecular weight of 329.42 g/mol, XLogP of 1.86, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2,5-dioxo-1-(3-oxobutyl)pyrrolidin-3-yl]sulfanylheptanoic acid is sourced from PubChem (CID 59687898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).