C33H34FN4O7P — CID 59688037
ethyl (2S)-2-[[3-[[7-[(4-fluorophenyl)methyl]-9-hydroxy-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carbonyl]amino]propyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 59688037) has the molecular formula C33H34FN4O7P and a molecular weight of 648.63 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-[[7-[(4-fluorophenyl)methyl]-9-hydroxy-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carbonyl]amino]propyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[3-[[7-[(4-fluorophenyl)methyl]-9-hydroxy-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carbonyl]amino]propyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59688037 |
| Molecular Formula | C33H34FN4O7P |
| Molecular Weight | 648.63 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | ethyl (2S)-2-[[3-[[7-[(4-fluorophenyl)methyl]-9-hydroxy-8-oxo-6H-pyrrolo[3,4-g]quinoline-5-carbonyl]amino]propyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CCCNC(=O)c1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2)Oc1ccccc1 |
| InChI | InChI=1S/C33H34FN4O7P/c1-3-44-33(42)21(2)37-46(43,45-24-9-5-4-6-10-24)18-8-17-36-31(40)27-25-11-7-16-35-29(25)30(39)28-26(27)20-38(32(28)41)19-22-12-14-23(34)15-13-22/h4-7,9-16,21,39H,3,8,17-20H2,1-2H3,(H,36,40)(H,37,43)/t21-,46?/m0/s1 |
| InChIKey | VTKGCTMPAXIWKB-WOBWPASZSA-N |
| XLogP | 5.17 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|