About N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide
N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide (PubChem CID 59688475) has the molecular formula C24H29N3O2
and a molecular weight of 391.52 g/mol. Its IUPAC name is N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide.
Molecular Properties
| Compound Name | N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide |
| PubChem CID | 59688475 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide |
| SMILES | CCCCNC(=O)N1CCC2(CC1)C(=O)N(c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-3-16-25-23(29)26-17-14-24(15-18-26)21(19-10-6-4-7-11-19)27(22(24)28)20-12-8-5-9-13-20/h4-13,21H,2-3,14-18H2,1H3,(H,25,29) |
| InChIKey | VYNRFIMJFJTFND-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide?
The IUPAC name of N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide (CID 59688475) is N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide.
What is the SMILES notation for N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide?
The canonical SMILES for N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide is CCCCNC(=O)N1CCC2(CC1)C(=O)N(c1ccccc1)C2c1ccccc1.
What is the InChIKey of N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide?
The InChIKey is VYNRFIMJFJTFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2/c1-2-3-16-25-23(29)26-17-14-24(15-18-26)21(19-10-6-4-7-11-19)27(22(24)28)20-12-8-5-9-13-20/h4-13,21H,2-3,14-18H2,1H3,(H,25,29).
What are the key properties of N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide?
N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide has a molecular weight of 391.52 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-oxo-1,2-diphenyl-2,7-diazaspiro[3.5]nonane-7-carboxamide is sourced from PubChem (CID 59688475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).