C30H38N4O2 — CID 59688607
[4-(4-aminophenyl)-3-[3-[methyl(propyl)amino]propoxy]phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone (PubChem CID 59688607) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is [4-(4-aminophenyl)-3-[3-[methyl(propyl)amino]propoxy]phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone.
| Compound Name | [4-(4-aminophenyl)-3-[3-[methyl(propyl)amino]propoxy]phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone |
|---|---|
| PubChem CID | 59688607 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | [4-(4-aminophenyl)-3-[3-[methyl(propyl)amino]propoxy]phenyl]-[(2S)-2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl]methanone |
| SMILES | CCCN(C)CCCOc1cc(C(=O)N2CC[C@H](C)Nc3ccccc32)ccc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C30H38N4O2/c1-4-17-33(3)18-7-20-36-29-21-24(12-15-26(29)23-10-13-25(31)14-11-23)30(35)34-19-16-22(2)32-27-8-5-6-9-28(27)34/h5-6,8-15,21-22,32H,4,7,16-20,31H2,1-3H3/t22-/m0/s1 |
| InChIKey | DAENTENLMFWXLY-QFIPXVFZSA-N |
| XLogP | 5.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|