C33H43ClN2O2 — CID 59688846
N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide (PubChem CID 59688846) has the molecular formula C33H43ClN2O2 and a molecular weight of 535.17 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide.
| Compound Name | N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 59688846 |
| Molecular Formula | C33H43ClN2O2 |
| Molecular Weight | 535.17 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3ccccc3Cl)o2)C2CCN(CCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C33H43ClN2O2/c1-4-5-6-9-26-12-14-27(15-13-26)33(37)36(28-19-22-35(23-20-28)21-18-25(2)3)24-29-16-17-32(38-29)30-10-7-8-11-31(30)34/h7-8,10-17,25,28H,4-6,9,18-24H2,1-3H3 |
| InChIKey | QMFPUOBOPWEENO-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.17 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|