C33H47N5O13 — CID 59689051
2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethyl 3-[[1,4-bis(2,5-dioxohexan-3-ylamino)-1,4-dioxobutan-2-yl]amino]-3-oxopropanoate (PubChem CID 59689051) has the molecular formula C33H47N5O13 and a molecular weight of 721.76 g/mol. Its IUPAC name is 2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethyl 3-[[1,4-bis(2,5-dioxohexan-3-ylamino)-1,4-dioxobutan-2-yl]amino]-3-oxopropanoate.
| Compound Name | 2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethyl 3-[[1,4-bis(2,5-dioxohexan-3-ylamino)-1,4-dioxobutan-2-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 59689051 |
| Molecular Formula | C33H47N5O13 |
| Molecular Weight | 721.76 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | 2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethyl 3-[[1,4-bis(2,5-dioxohexan-3-ylamino)-1,4-dioxobutan-2-yl]amino]-3-oxopropanoate |
| SMILES | CC(=O)CC(NC(=O)CC(NC(=O)CC(=O)OCCOCCNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(CC(C)=O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C33H47N5O13/c1-20(39)16-24(22(3)41)35-28(44)18-26(33(49)37-25(23(4)42)17-21(2)40)36-29(45)19-32(48)51-15-14-50-13-11-34-27(43)8-6-5-7-12-38-30(46)9-10-31(38)47/h9-10,24-26H,5-8,11-19H2,1-4H3,(H,34,43)(H,35,44)(H,36,45)(H,37,49) |
| InChIKey | FSRAHTAVONLRLK-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 257.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.76 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|