C6H6BrF7O — CID 59689354
2-(3-bromopropoxy)-1,1,1,2,3,3,3-heptafluoropropane (PubChem CID 59689354) has the molecular formula C6H6BrF7O and a molecular weight of 307.00 g/mol. Its IUPAC name is 2-(3-bromopropoxy)-1,1,1,2,3,3,3-heptafluoropropane.
| Compound Name | 2-(3-bromopropoxy)-1,1,1,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 59689354 |
| Molecular Formula | C6H6BrF7O |
| Molecular Weight | 307.00 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 2-(3-bromopropoxy)-1,1,1,2,3,3,3-heptafluoropropane |
| SMILES | FC(F)(F)C(F)(OCCCBr)C(F)(F)F |
| InChI | InChI=1S/C6H6BrF7O/c7-2-1-3-15-4(8,5(9,10)11)6(12,13)14/h1-3H2 |
| InChIKey | ZFISDNLFBQOCNR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.00 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|