C25H23N9O — CID 59690004
N-cyano-N'-(2-methylphenyl)-3-phenyl-4-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 59690004) has the molecular formula C25H23N9O and a molecular weight of 465.52 g/mol. Its IUPAC name is N-cyano-N'-(2-methylphenyl)-3-phenyl-4-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-(2-methylphenyl)-3-phenyl-4-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59690004 |
| Molecular Formula | C25H23N9O |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-cyano-N'-(2-methylphenyl)-3-phenyl-4-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(C(=O)c2nc3ncccn3n2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H23N9O/c1-18-8-5-6-11-20(18)29-24(28-17-26)32-14-15-33(21(16-32)19-9-3-2-4-10-19)23(35)22-30-25-27-12-7-13-34(25)31-22/h2-13,21H,14-16H2,1H3,(H,28,29) |
| InChIKey | KCEPJCOKFOYOQV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|