C21H24ClN7S — CID 59690043
4-(6-amino-2-chloropyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide (PubChem CID 59690043) has the molecular formula C21H24ClN7S and a molecular weight of 441.99 g/mol. Its IUPAC name is 4-(6-amino-2-chloropyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide.
| Compound Name | 4-(6-amino-2-chloropyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59690043 |
| Molecular Formula | C21H24ClN7S |
| Molecular Weight | 441.99 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-(6-amino-2-chloropyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)C1CN(c2cc(N)nc(Cl)n2)CCN1C(=S)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C21H24ClN7S/c1-13(2)17-12-28(19-11-18(23)26-20(22)27-19)9-10-29(17)21(30)25-16-7-3-6-15-14(16)5-4-8-24-15/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,25,30)(H2,23,26,27) |
| InChIKey | HKVLCBUWUMVOKX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.99 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|