C26H28N10 — CID 59690135
N-cyano-4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide (PubChem CID 59690135) has the molecular formula C26H28N10 and a molecular weight of 480.58 g/mol. Its IUPAC name is N-cyano-4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59690135 |
| Molecular Formula | C26H28N10 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-cyano-4-[6-(1-methylpyrazol-4-yl)pyrazin-2-yl]-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide |
| SMILES | CC(C)C1CN(c2cncc(-c3cnn(C)c3)n2)CCN1/C(=N/c1cccc2ncccc12)NC#N |
| InChI | InChI=1S/C26H28N10/c1-18(2)24-16-35(25-14-28-13-23(32-25)19-12-31-34(3)15-19)10-11-36(24)26(30-17-27)33-22-8-4-7-21-20(22)6-5-9-29-21/h4-9,12-15,18,24H,10-11,16H2,1-3H3,(H,30,33) |
| InChIKey | BLNROOLSVOIMEQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|