C25H23N7O3S — CID 59690338
4-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide (PubChem CID 59690338) has the molecular formula C25H23N7O3S and a molecular weight of 501.57 g/mol. Its IUPAC name is 4-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59690338 |
| Molecular Formula | C25H23N7O3S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 4-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N-cyano-N'-(2-methylphenyl)-3-phenylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(S(=O)(=O)c2cccc3nonc23)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H23N7O3S/c1-18-8-5-6-11-20(18)28-25(27-17-26)31-14-15-32(22(16-31)19-9-3-2-4-10-19)36(33,34)23-13-7-12-21-24(23)30-35-29-21/h2-13,22H,14-16H2,1H3,(H,27,28) |
| InChIKey | DPHGEQXTYOLMKU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|