C28H27F2N7O — CID 59690660
4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-N-(3,4-difluorophenyl)-2-phenylpiperazine-1-carboxamide (PubChem CID 59690660) has the molecular formula C28H27F2N7O and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-N-(3,4-difluorophenyl)-2-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-N-(3,4-difluorophenyl)-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59690660 |
| Molecular Formula | C28H27F2N7O |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 4-[N-cyano-N'-(1,2,3,4-tetrahydroisoquinolin-5-yl)carbamimidoyl]-N-(3,4-difluorophenyl)-2-phenylpiperazine-1-carboxamide |
| SMILES | N#CN/C(=N\c1cccc2c1CCNC2)N1CCN(C(=O)Nc2ccc(F)c(F)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C28H27F2N7O/c29-23-10-9-21(15-24(23)30)34-28(38)37-14-13-36(17-26(37)19-5-2-1-3-6-19)27(33-18-31)35-25-8-4-7-20-16-32-12-11-22(20)25/h1-10,15,26,32H,11-14,16-17H2,(H,33,35)(H,34,38) |
| InChIKey | LTGIXUVBRFLPFV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|