About 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole
2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole (PubChem CID 59691075) has the molecular formula C27H18N2O
and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole.
Molecular Properties
| Compound Name | 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole |
| PubChem CID | 59691075 |
| Molecular Formula | C27H18N2O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole |
| SMILES | c1ccc(-c2ccc(-c3c(-c4ccccc4)nc4oc5ccccc5n34)cc2)cc1 |
| InChI | InChI=1S/C27H18N2O/c1-3-9-19(10-4-1)20-15-17-22(18-16-20)26-25(21-11-5-2-6-12-21)28-27-29(26)23-13-7-8-14-24(23)30-27/h1-18H |
| InChIKey | MJPJYDMPRQLSDW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole?
The IUPAC name of 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole (CID 59691075) is 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole.
What is the SMILES notation for 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole?
The canonical SMILES for 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole is c1ccc(-c2ccc(-c3c(-c4ccccc4)nc4oc5ccccc5n34)cc2)cc1.
What is the InChIKey of 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole?
The InChIKey is MJPJYDMPRQLSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18N2O/c1-3-9-19(10-4-1)20-15-17-22(18-16-20)26-25(21-11-5-2-6-12-21)28-27-29(26)23-13-7-8-14-24(23)30-27/h1-18H.
What are the key properties of 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole?
2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole has a molecular weight of 386.45 g/mol, XLogP of 7.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1-(4-phenylphenyl)imidazo[2,1-b][1,3]benzoxazole is sourced from PubChem (CID 59691075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).