C29H41N5O4 — CID 59691318
12,16-dimethyl-6-methylidene-9-[(5-methyl-1H-indol-3-yl)methyl]-3-(2-methylpropyl)-1,4,7,10-tetrazacyclohexadecane-2,5,8,11-tetrone (PubChem CID 59691318) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is 12,16-dimethyl-6-methylidene-9-[(5-methyl-1H-indol-3-yl)methyl]-3-(2-methylpropyl)-1,4,7,10-tetrazacyclohexadecane-2,5,8,11-tetrone.
| Compound Name | 12,16-dimethyl-6-methylidene-9-[(5-methyl-1H-indol-3-yl)methyl]-3-(2-methylpropyl)-1,4,7,10-tetrazacyclohexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 59691318 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 12,16-dimethyl-6-methylidene-9-[(5-methyl-1H-indol-3-yl)methyl]-3-(2-methylpropyl)-1,4,7,10-tetrazacyclohexadecane-2,5,8,11-tetrone |
| SMILES | C=C1NC(=O)C(Cc2c[nH]c3ccc(C)cc23)NC(=O)C(C)CCCC(C)NC(=O)C(CC(C)C)NC1=O |
| InChI | InChI=1S/C29H41N5O4/c1-16(2)12-24-28(37)31-19(5)9-7-8-18(4)26(35)33-25(29(38)32-20(6)27(36)34-24)14-21-15-30-23-11-10-17(3)13-22(21)23/h10-11,13,15-16,18-19,24-25,30H,6-9,12,14H2,1-5H3,(H,31,37)(H,32,38)(H,33,35)(H,34,36) |
| InChIKey | HUDKJXZSVKYQNG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|