C27H33ClF3N3O2 — CID 59691365
1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea (PubChem CID 59691365) has the molecular formula C27H33ClF3N3O2 and a molecular weight of 524.03 g/mol. Its IUPAC name is 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 59691365 |
| Molecular Formula | C27H33ClF3N3O2 |
| Molecular Weight | 524.03 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 1-[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](NC(=O)Nc5ccc(Cl)cc5C(F)(F)F)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C27H33ClF3N3O2/c1-25-12-10-18-16(5-9-22-26(18,2)13-11-23(35)34(22)3)17(25)6-8-21(25)33-24(36)32-20-7-4-15(28)14-19(20)27(29,30)31/h4,7,11,13-14,16-18,21-22H,5-6,8-10,12H2,1-3H3,(H2,32,33,36)/t16-,17-,18-,21-,22+,25-,26+/m0/s1 |
| InChIKey | HUVAJTJWIICQKE-OOXAWIBKSA-N |
| XLogP | 6.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.03 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |