About (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine
(3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 59691485) has the molecular formula C9H19NO2S
and a molecular weight of 205.32 g/mol. Its IUPAC name is (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 59691485 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN([C@@H]1CCS(=O)(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C9H19NO2S/c1-9(2,3)10(4)8-5-6-13(11,12)7-8/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | GHSPQEXYRDITDN-MRVPVSSYSA-N |
| XLogP | 0.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine (CID 59691485) is (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine is CN([C@@H]1CCS(=O)(=O)C1)C(C)(C)C.
What is the InChIKey of (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is GHSPQEXYRDITDN-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H19NO2S/c1-9(2,3)10(4)8-5-6-13(11,12)7-8/h8H,5-7H2,1-4H3/t8-/m1/s1.
What are the key properties of (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine?
(3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 205.32 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-tert-butyl-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 59691485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).