About 4-nonanoylbenzaldehyde
4-nonanoylbenzaldehyde (PubChem CID 59691825) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-nonanoylbenzaldehyde.
Molecular Properties
| Compound Name | 4-nonanoylbenzaldehyde |
| PubChem CID | 59691825 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-nonanoylbenzaldehyde |
| SMILES | CCCCCCCCC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C16H22O2/c1-2-3-4-5-6-7-8-16(18)15-11-9-14(13-17)10-12-15/h9-13H,2-8H2,1H3 |
| InChIKey | RXPRCFWZGOZISA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nonanoylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonanoylbenzaldehyde?
The IUPAC name of 4-nonanoylbenzaldehyde (CID 59691825) is 4-nonanoylbenzaldehyde.
What is the SMILES notation for 4-nonanoylbenzaldehyde?
The canonical SMILES for 4-nonanoylbenzaldehyde is CCCCCCCCC(=O)c1ccc(C=O)cc1.
What is the InChIKey of 4-nonanoylbenzaldehyde?
The InChIKey is RXPRCFWZGOZISA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-2-3-4-5-6-7-8-16(18)15-11-9-14(13-17)10-12-15/h9-13H,2-8H2,1H3.
What are the key properties of 4-nonanoylbenzaldehyde?
4-nonanoylbenzaldehyde has a molecular weight of 246.35 g/mol, XLogP of 4.43, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonanoylbenzaldehyde is sourced from PubChem (CID 59691825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).