About N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide
N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide (PubChem CID 59691865) has the molecular formula C22H16F2N2O4S
and a molecular weight of 442.44 g/mol. Its IUPAC name is N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide |
| PubChem CID | 59691865 |
| Molecular Formula | C22H16F2N2O4S |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(F)cc4F)oc3c2)c1 |
| InChI | InChI=1S/C22H16F2N2O4S/c1-31(28,29)26-15-4-2-3-12(9-15)13-5-7-17-19(10-13)30-22(20(17)25)21(27)16-8-6-14(23)11-18(16)24/h2-11,26H,25H2,1H3 |
| InChIKey | DGKHRVSFLRZZFV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide (CID 59691865) is N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(F)cc4F)oc3c2)c1.
What is the InChIKey of N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide?
The InChIKey is DGKHRVSFLRZZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N2O4S/c1-31(28,29)26-15-4-2-3-12(9-15)13-5-7-17-19(10-13)30-22(20(17)25)21(27)16-8-6-14(23)11-18(16)24/h2-11,26H,25H2,1H3.
What are the key properties of N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide?
N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide has a molecular weight of 442.44 g/mol, XLogP of 4.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[3-amino-2-(2,4-difluorobenzoyl)-1-benzofuran-6-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 59691865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).