C24H14Cl2F4N2O3 — CID 59691917
N-[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 59691917) has the molecular formula C24H14Cl2F4N2O3 and a molecular weight of 525.29 g/mol. Its IUPAC name is N-[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 59691917 |
| Molecular Formula | C24H14Cl2F4N2O3 |
| Molecular Weight | 525.29 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | N-[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | Nc1c(C(=O)c2ccc(Cl)cc2Cl)oc2cc(-c3cccc(NC(=O)C(F)(F)C(F)F)c3)ccc12 |
| InChI | InChI=1S/C24H14Cl2F4N2O3/c25-13-5-7-15(17(26)10-13)20(33)21-19(31)16-6-4-12(9-18(16)35-21)11-2-1-3-14(8-11)32-23(34)24(29,30)22(27)28/h1-10,22H,31H2,(H,32,34) |
| InChIKey | LULXBSDWNGWNTF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.29 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|