C23H18FNO4S — CID 59692799
1-[(7-fluoro-9H-fluoren-2-yl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 59692799) has the molecular formula C23H18FNO4S and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[(7-fluoro-9H-fluoren-2-yl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid.
| Compound Name | 1-[(7-fluoro-9H-fluoren-2-yl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 59692799 |
| Molecular Formula | C23H18FNO4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-[(7-fluoro-9H-fluoren-2-yl)sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)c2ccc3c(c2)Cc2cc(F)ccc2-3)CC1c1ccccc1 |
| InChI | InChI=1S/C23H18FNO4S/c24-17-6-8-19-15(11-17)10-16-12-18(7-9-20(16)19)30(28,29)25-23(22(26)27)13-21(23)14-4-2-1-3-5-14/h1-9,11-12,21,25H,10,13H2,(H,26,27) |
| InChIKey | GWSHMBACNVHYEJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |