C19H13F5N2O5S2 — CID 59692834
cis-(1S,2S)-1-[[5-[5-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-3-yl]thiophen-2-yl]sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 59692834) has the molecular formula C19H13F5N2O5S2 and a molecular weight of 508.45 g/mol. Its IUPAC name is cis-(1S,2S)-1-[[5-[5-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-3-yl]thiophen-2-yl]sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,2S)-1-[[5-[5-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-3-yl]thiophen-2-yl]sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 59692834 |
| Molecular Formula | C19H13F5N2O5S2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | cis-(1S,2S)-1-[[5-[5-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-3-yl]thiophen-2-yl]sulfonylamino]-2-phenylcyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(NS(=O)(=O)c2ccc(-c3cc(C(F)(F)C(F)(F)F)on3)s2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H13F5N2O5S2/c20-18(21,19(22,23)24)14-8-12(25-31-14)13-6-7-15(32-13)33(29,30)26-17(16(27)28)9-11(17)10-4-2-1-3-5-10/h1-8,11,26H,9H2,(H,27,28)/t11-,17-/m0/s1 |
| InChIKey | YPFMXNNSDDPXMH-GTNSWQLSSA-N |
| XLogP | 4.35 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|