C18H23N3O3S2 — CID 59693051
N-[(E)-2-[2-(4-methylpent-3-enyl)-1,3-dithiolan-2-yl]ethylideneamino]-4-nitrobenzamide (PubChem CID 59693051) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[(E)-2-[2-(4-methylpent-3-enyl)-1,3-dithiolan-2-yl]ethylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-2-[2-(4-methylpent-3-enyl)-1,3-dithiolan-2-yl]ethylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 59693051 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[(E)-2-[2-(4-methylpent-3-enyl)-1,3-dithiolan-2-yl]ethylideneamino]-4-nitrobenzamide |
| SMILES | CC(C)=CCCC1(C/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)SCCS1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-14(2)4-3-9-18(25-12-13-26-18)10-11-19-20-17(22)15-5-7-16(8-6-15)21(23)24/h4-8,11H,3,9-10,12-13H2,1-2H3,(H,20,22)/b19-11+ |
| InChIKey | QWTHLAKHNUCYRC-YBFXNURJSA-N |
| XLogP | 4.62 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|