C23H31N5O — CID 59693703
(3S)-3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-4-methyl-1-(2-naphthalen-2-ylethyl)piperazin-2-one (PubChem CID 59693703) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is (3S)-3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-4-methyl-1-(2-naphthalen-2-ylethyl)piperazin-2-one.
| Compound Name | (3S)-3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-4-methyl-1-(2-naphthalen-2-ylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 59693703 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (3S)-3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl]-4-methyl-1-(2-naphthalen-2-ylethyl)piperazin-2-one |
| SMILES | CN1CCN(CCc2ccc3ccccc3c2)C(=O)[C@@H]1CCCNC1=NCCN1 |
| InChI | InChI=1S/C23H31N5O/c1-27-15-16-28(14-10-18-8-9-19-5-2-3-6-20(19)17-18)22(29)21(27)7-4-11-24-23-25-12-13-26-23/h2-3,5-6,8-9,17,21H,4,7,10-16H2,1H3,(H2,24,25,26)/t21-/m0/s1 |
| InChIKey | YTRVAKPRRMLILV-NRFANRHFSA-N |
| XLogP | 1.85 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|