C13H11N5O4 — CID 59693797
2-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetic acid (PubChem CID 59693797) has the molecular formula C13H11N5O4 and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 59693797 |
| Molecular Formula | C13H11N5O4 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[4-methoxy-7-(5-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetic acid |
| SMILES | COc1cnc(-n2ncnc2C)c2[nH]cc(C(=O)C(=O)O)c12 |
| InChI | InChI=1S/C13H11N5O4/c1-6-16-5-17-18(6)12-10-9(8(22-2)4-15-12)7(3-14-10)11(19)13(20)21/h3-5,14H,1-2H3,(H,20,21) |
| InChIKey | RGLGDVMMQRVQGZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|