About tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane
tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane (PubChem CID 59693891) has the molecular formula C15H30N2SSn
and a molecular weight of 389.20 g/mol. Its IUPAC name is tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane |
| PubChem CID | 59693891 |
| Molecular Formula | C15H30N2SSn |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nc(C)ns1 |
| InChI | InChI=1S/3C4H9.C3H3N2S.Sn/c3*1-3-4-2;1-3-4-2-6-5-3;/h3*1,3-4H2,2H3;1H3; |
| InChIKey | HBOBCVOCFXSYAJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane?
The IUPAC name of tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane (CID 59693891) is tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane.
What is the SMILES notation for tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane?
The canonical SMILES for tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1nc(C)ns1.
What is the InChIKey of tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane?
The InChIKey is HBOBCVOCFXSYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H3N2S.Sn/c3*1-3-4-2;1-3-4-2-6-5-3;/h3*1,3-4H2,2H3;1H3;.
What are the key properties of tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane?
tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane has a molecular weight of 389.20 g/mol, XLogP of 4.90, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(3-methyl-1,2,4-thiadiazol-5-yl)stannane is sourced from PubChem (CID 59693891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).