C21H18BrFN4O3 — CID 59693919
1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-bromo-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione (PubChem CID 59693919) has the molecular formula C21H18BrFN4O3 and a molecular weight of 473.30 g/mol. Its IUPAC name is 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-bromo-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-bromo-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 59693919 |
| Molecular Formula | C21H18BrFN4O3 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-bromo-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)C(=O)c2c[nH]c3c(Br)ncc(F)c23)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18BrFN4O3/c1-12-11-26(7-8-27(12)20(29)13-5-3-2-4-6-13)21(30)18(28)14-9-24-17-16(14)15(23)10-25-19(17)22/h2-6,9-10,12,24H,7-8,11H2,1H3/t12-/m1/s1 |
| InChIKey | GIQUOTQGORBRPF-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|