About CID 59694590
CID 59694590 (PubChem CID 59694590) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol.
Molecular Properties
| Compound Name | CID 59694590 |
| PubChem CID | 59694590 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | — |
| SMILES | [CH]CCNCc1cccc(OCc2ccncc2)c1 |
| InChI | InChI=1S/C16H18N2O/c1-2-8-18-12-15-4-3-5-16(11-15)19-13-14-6-9-17-10-7-14/h1,3-7,9-11,18H,2,8,12-13H2 |
| InChIKey | SZCSRGPMJUWKTO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59694590 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59694590?
The IUPAC name of CID 59694590 (CID 59694590) is not available.
What is the SMILES notation for CID 59694590?
The canonical SMILES for CID 59694590 is [CH]CCNCc1cccc(OCc2ccncc2)c1.
What is the InChIKey of CID 59694590?
The InChIKey is SZCSRGPMJUWKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-2-8-18-12-15-4-3-5-16(11-15)19-13-14-6-9-17-10-7-14/h1,3-7,9-11,18H,2,8,12-13H2.
What are the key properties of CID 59694590?
CID 59694590 has a molecular weight of 254.33 g/mol, XLogP of 2.85, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59694590 is sourced from PubChem (CID 59694590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).