About CID 59694689
CID 59694689 (PubChem CID 59694689) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol.
Molecular Properties
| Compound Name | CID 59694689 |
| PubChem CID | 59694689 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | — |
| SMILES | [CH]C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H17N/c1-12-6-5-9-14(10-12)11-13-7-3-2-4-8-13/h1-4,7-8,12H,5-6,9-11H2 |
| InChIKey | OIGJBPUVSOTREV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59694689 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59694689?
The IUPAC name of CID 59694689 (CID 59694689) is not available.
What is the SMILES notation for CID 59694689?
The canonical SMILES for CID 59694689 is [CH]C1CCCN(Cc2ccccc2)C1.
What is the InChIKey of CID 59694689?
The InChIKey is OIGJBPUVSOTREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-12-6-5-9-14(10-12)11-13-7-3-2-4-8-13/h1-4,7-8,12H,5-6,9-11H2.
What are the key properties of CID 59694689?
CID 59694689 has a molecular weight of 187.29 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59694689 is sourced from PubChem (CID 59694689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).