C11H14N2 — CID 59694740
CID 59694740 (PubChem CID 59694740) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol.
| Compound Name | CID 59694740 |
|---|---|
| PubChem CID | 59694740 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | — |
| SMILES | [CH]C1CCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C11H14N2/c1-10-5-7-13(8-10)9-11-4-2-3-6-12-11/h1-4,6,10H,5,7-9H2 |
| InChIKey | UWBAFOQPIOTHCD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |